PhyslibSearch

Physlib.Mathematics.Fin.Involutions

22 declarations

definition

Equivalence between Inv(Fin(n+1))\text{Inv}(\text{Fin}(n+1)) and Inv(Fin n)\text{Inv}(\text{Fin } n) with an optional fixed point

#involutionCons

There is an equivalence (bijection) between the set of involutions on Fin(n+1)\text{Fin}(n+1) and the set of pairs (f,i)(f, i), where ff is an involution on Fin n\text{Fin } n and ii is an element of Option(Fin n)\text{Option}(\text{Fin } n) satisfying the condition that if ii is some jFin n\text{some } j \in \text{Fin } n, then jj must be a fixed point of ff (i.e., f(j)=jf(j) = j). Under this mapping, an involution gg on Fin(n+1)\text{Fin}(n+1) is decomposed based on the image of 00: 1. If g(0)=0g(0) = 0, then i=nonei = \text{none} and ff is the restriction of gg to {1,,n}\{1, \dots, n\}. 2. If g(0)=k+1g(0) = k+1 (and thus g(k+1)=0g(k+1) = 0 by involutivity), then i=some ki = \text{some } k and ff is the involution on Fin n\text{Fin } n where kk is treated as a fixed point.

theorem

Extensionality for pairs of involutions and optional fixed points on Fin n\text{Fin } n

#involutionCons_ext

Let nn be a natural number. Let Inv(n)\text{Inv}(n) be the set of involutions on Fin n={0,1,,n1}\text{Fin } n = \{0, 1, \dots, n-1\}, which are functions ff such that f(f(x))=xf(f(x)) = x for all xx. Consider the set of pairs (f,i)(f, i) such that fInv(n)f \in \text{Inv}(n) and ii is either an element of Fin n\text{Fin } n that is a fixed point of ff (i.e., f(i)=if(i) = i) or i=nonei = \text{none}. For any two such pairs f1=(f,i)f_1 = (f, i) and f2=(g,j)f_2 = (g, j), if f=gf = g and i=ji = j, then f1=f2f_1 = f_2.

definition

Optional fixed point of fOption(Fin S)f \simeq \text{Option}(\text{Fin } |S|)

#involutionAddEquiv

Given a natural number nn and an involution f:Fin nFin nf: \text{Fin } n \to \text{Fin } n, let S={iFin nf(i)=i}S = \{i \in \text{Fin } n \mid f(i) = i\} be the set of fixed points of ff. This definition provides an equivalence between the set of optional fixed points of ff (which contains either a value `none` or a value `some i` where ii is a fixed point of ff) and the set Option(Fin S)\text{Option}(\text{Fin } |S|).

theorem

`involutionAddEquiv` is `none` implies f(0)=0f(0) = 0

#involutionAddEquiv_none_image_zero

Let nn be a natural number and f:Fin(n+1)Fin(n+1)f: \text{Fin}(n+1) \to \text{Fin}(n+1) be an involution. Let (f,i)(f', i) be the pair obtained by decomposing ff via the equivalence `involutionCons`, where ff' is an involution on Fin n\text{Fin } n and ii is an optional fixed point of ff'. If the mapping of this optional fixed point ii under `involutionAddEquiv` (with respect to ff') results in `none`, then f(0)=0f(0) = 0.

theorem

`involutionAddEquiv` is consistent under f1=f2f_1 = f_2

#involutionAddEquiv_cast

Let nn be a natural number and let f1,f2:Fin nFin nf_1, f_2: \text{Fin } n \to \text{Fin } n be two involutions. Suppose f1=f2f_1 = f_2. Let S1S_1 and S2S_2 be the sets of fixed points of f1f_1 and f2f_2 respectively. The theorem states that the equivalence involutionAddEquiv f1\text{involutionAddEquiv } f_1—which identifies the optional fixed points of f1f_1 (the set of iOption(Fin n)i \in \text{Option}(\text{Fin } n) such that if i=some xi = \text{some } x, then f1(x)=xf_1(x) = x) with the set Option(Fin S1)\text{Option}(\text{Fin } |S_1|)—is equal to the composition of: 1. The equivalence between the optional fixed points of f1f_1 and those of f2f_2 induced by the equality f1=f2f_1 = f_2. 2. The equivalence involutionAddEquiv f2\text{involutionAddEquiv } f_2 mapping the optional fixed points of f2f_2 to Option(Fin S2)\text{Option}(\text{Fin } |S_2|). 3. The equivalence between Option(Fin S2)\text{Option}(\text{Fin } |S_2|) and Option(Fin S1)\text{Option}(\text{Fin } |S_1|) induced by the equality of the number of fixed points S1=S2|S_1| = |S_2|.

theorem

Equality of the Inverse of `involutionAddEquiv` under Involution Equality

#involutionAddEquiv_cast'

Let mm be a natural number and let f1,f2:Fin mFin mf_1, f_2: \text{Fin } m \to \text{Fin } m be two involutions. Suppose f1=f2f_1 = f_2. Let NN be a natural number such that NN is the cardinality of the set of fixed points of f1f_1 (and thus also of f2f_2). For any nOption(Fin N)n \in \text{Option}(\text{Fin } N), the inverse of the equivalence `involutionAddEquiv` (which relates optional fixed points to the set Option(Fin N)\text{Option}(\text{Fin } N)) applied to nn for the involution f1f_1 is heterogeneously equal to the inverse of the equivalence applied to nn for f2f_2.

theorem

f(x+1)=x+1    f(x)=xf(x+1) = x+1 \iff f'(x) = x when f(0)=0f(0) = 0

#involutionAddEquiv_none_succ

Let nn be a natural number and let ff be an involution on the set Fin(n+1)={0,1,,n}\text{Fin}(n+1) = \{0, 1, \dots, n\}. Let (f,i)(f', i) be the decomposition of ff into an involution ff' on Fin n\text{Fin } n and an optional fixed point ii provided by the equivalence `involutionCons`. Suppose that the mapping of this decomposition under `involutionAddEquiv` results in `none` (which occurs when f(0)=0f(0) = 0 and i=nonei = \text{none}). Then, for any element xFin nx \in \text{Fin } n, the successor x+1x+1 is a fixed point of ff (i.e., f(x+1)=x+1f(x+1) = x+1) if and only if xx is a fixed point of ff' (i.e., f(x)=xf'(x) = x).

definition

Invfpf(Fin(n+1))kFin n{fInvfpff(0)=k+1}\text{Inv}_{\text{fpf}}(\text{Fin}(n+1)) \simeq \sum_{k \in \text{Fin } n} \{f \in \text{Inv}_{\text{fpf}} \mid f(0) = k+1\}

#involutionNoFixedEquivSum

For a natural number nn, let SS be the set of fixed-point-free involutions on the finite set Fin(n+1)={0,1,,n}\text{Fin}(n+1) = \{0, 1, \dots, n\}, which are functions f:Fin(n+1)Fin(n+1)f: \text{Fin}(n+1) \to \text{Fin}(n+1) satisfying f(f(i))=if(f(i)) = i and f(i)if(i) \neq i for all ii. This equivalence states that SS is in one-to-one correspondence with the disjoint union (sigma-type) over k{0,1,,n1}k \in \{0, 1, \dots, n-1\} of the sets of fixed-point-free involutions ff such that f(0)=k+1f(0) = k+1. In other words, fixed-point-free involutions of Fin(n+1)\text{Fin}(n+1) can be uniquely partitioned based on the image of 00.

definition

Equivalence of fixed-point-free involutions with f(0)=k+1f(0) = k+1 via conjugation by ee

#involutionNoFixedZeroSetEquivEquiv

Given nNn \in \mathbb{N}, an element kFin nk \in \text{Fin } n, and a permutation ee of Fin(n+1)\text{Fin}(n+1), there exists an equivalence between the set of fixed-point-free involutions ff on Fin(n+1)\text{Fin}(n+1) such that f(0)=k+1f(0) = k+1 and the set of functions ff on Fin(n+1)\text{Fin}(n+1) such that the conjugate e1fee^{-1} \circ f \circ e is a fixed-point-free involution satisfying (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1.

definition

Conjugation invariance of fixed-point free involutions with fixed value (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1

#involutionNoFixedZeroSetEquivSetEquiv

Given a natural number nn, a value k{0,,n1}k \in \{0, \dots, n-1\}, and a permutation ee of the set {0,1,,n}\{0, 1, \dots, n\}, there is an equivalence between: 1. The set of functions f:{0,,n}{0,,n}f: \{0, \dots, n\} \to \{0, \dots, n\} such that the conjugate function e1fee^{-1} \circ f \circ e is an involution with no fixed points (i.e., (e1fe)(e1fe)=id(e^{-1} \circ f \circ e) \circ (e^{-1} \circ f \circ e) = \text{id} and (e1fe)(i)i(e^{-1} \circ f \circ e)(i) \neq i for all ii) satisfying the condition (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1. 2. The set of functions f:{0,,n}{0,,n}f: \{0, \dots, n\} \to \{0, \dots, n\} such that ff itself is an involution with no fixed points satisfying the same condition (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1. This equivalence holds because a function ff is a fixed-point free involution if and only if its conjugate e1fee^{-1} \circ f \circ e is also a fixed-point free involution.

definition

{f(e1fe)(0)=k+1}{ff(e(0))=e(k+1)}\{f \mid (e^{-1} \circ f \circ e)(0) = k+1\} \simeq \{f \mid f(e(0)) = e(k+1)\} for fixed-point-free involutions

#involutionNoFixedZeroSetEquivEquiv'

Given a natural number nn, an index k{0,,n1}k \in \{0, \dots, n-1\}, and a permutation ee of the set {0,,n}\{0, \dots, n\}, there is an equivalence between: 1. The set of functions f:{0,,n}{0,,n}f: \{0, \dots, n\} \to \{0, \dots, n\} that are involutions (ff=idf \circ f = \text{id}), have no fixed points (f(i)if(i) \neq i for all ii), and satisfy (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1. 2. The set of functions f:{0,,n}{0,,n}f: \{0, \dots, n\} \to \{0, \dots, n\} that are involutions, have no fixed points, and satisfy f(e(0))=e(k+1)f(e(0)) = e(k+1). This equivalence arises because the condition (e1fe)(0)=k+1(e^{-1} \circ f \circ e)(0) = k+1 is mathematically equivalent to f(e(0))=e(k+1)f(e(0)) = e(k+1).

definition

{ff(0)=k+1}{ff(0)=1}\{f \mid f(0) = k+1\} \simeq \{f \mid f(0) = 1\} for fixed-point-free involutions

#involutionNoFixedZeroSetEquivSetOne

For any natural number nn and any element k{0,,n}k \in \{0, \dots, n\}, there is an equivalence between the set of fixed-point-free involutions ff on the set Fin(n+2)={0,1,,n+1}\text{Fin}(n+2) = \{0, 1, \dots, n+1\} that satisfy f(0)=k+1f(0) = k+1 and the set of fixed-point-free involutions on the same set that satisfy f(0)=1f(0) = 1. Here, an involution is a function such that f(f(i))=if(f(i)) = i for all ii, and being fixed-point-free means f(i)if(i) \neq i for all ii.

definition

Equivalence of fixed-point-free involutions f:Fin(n+2)Fin(n+2)f: \text{Fin}(n+2) \to \text{Fin}(n+2) with f(0)=1f(0)=1 and fixed-point-free involutions of Fin(n)\text{Fin}(n)

#involutionNoFixedSetOne

For any natural number nn, the set of fixed-point-free involutions f:Fin(n+2)Fin(n+2)f: \text{Fin}(n+2) \to \text{Fin}(n+2) satisfying the condition f(0)=1f(0) = 1 is equivalent (in one-to-one correspondence) to the set of fixed-point-free involutions g:Fin(n)Fin(n)g: \text{Fin}(n) \to \text{Fin}(n). Here, Fin(k)\text{Fin}(k) denotes the set of natural numbers {0,1,,k1}\{0, 1, \dots, k-1\}, and an involution is a function such that f(f(i))=if(f(i)) = i for all ii. The condition f(0)=1f(0) = 1 implies f(1)=0f(1) = 0 for such involutions, and the remaining nn elements are mapped to each other via a fixed-point-free involution on a set of size nn.

definition

Equivalence of fixed-point-free involutions f:Fin(n+2)Fin(n+2)f: \text{Fin}(n+2) \to \text{Fin}(n+2) with f(0)=k+1f(0)=k+1 and fixed-point-free involutions of Fin(n)\text{Fin}(n)

#involutionNoFixedZeroSetEquiv

For any natural number nn and any element k{0,,n}k \in \{0, \dots, n\} (represented as kFin(n+1)k \in \text{Fin}(n+1)), there exists a one-to-one correspondence between the set of fixed-point-free involutions f:Fin(n+2)Fin(n+2)f: \text{Fin}(n+2) \to \text{Fin}(n+2) satisfying f(0)=k+1f(0) = k+1 and the set of fixed-point-free involutions g:Fin(n)Fin(n)g: \text{Fin}(n) \to \text{Fin}(n). Here, Fin(m)\text{Fin}(m) denotes the set of natural numbers {0,1,,m1}\{0, 1, \dots, m-1\}, an involution is a function such that f(f(i))=if(f(i)) = i for all ii, and being fixed-point-free means f(i)if(i) \neq i for all ii.

definition

Invfpf(Fin(n+2))kFin(n+1)Invfpf(Fin(n))\text{Inv}_{\text{fpf}}(\text{Fin}(n+2)) \simeq \sum_{k \in \text{Fin}(n+1)} \text{Inv}_{\text{fpf}}(\text{Fin}(n))

#involutionNoFixedEquivSumSame

For any natural number nn, there exists an equivalence between the set of fixed-point-free involutions on Fin(n+2)={0,1,,n+1}\text{Fin}(n+2) = \{0, 1, \dots, n+1\} and the disjoint union (sigma type) of n+1n+1 copies of the set of fixed-point-free involutions on Fin(n)={0,1,,n1}\text{Fin}(n) = \{0, 1, \dots, n-1\}. Here, an involution is a function ff such that f(f(i))=if(f(i)) = i for all ii, and it is fixed-point-free if f(i)if(i) \neq i for all ii. The correspondence is given by: \[ \{ f : \text{Fin}(n+2) \to \text{Fin}(n+2) \mid f \circ f = \text{id}, \forall i, f(i) \neq i \} \simeq \sum_{k \in \text{Fin}(n+1)} \{ g : \text{Fin}(n) \to \text{Fin}(n) \mid g \circ g = \text{id}, \forall i, g(i) \neq i \} \] This equivalence arises because any fixed-point-free involution on n+2n+2 elements must map 00 to some element j{1,,n+1}j \in \{1, \dots, n+1\}. There are n+1n+1 such choices for jj, and for each choice, the remaining nn elements must be permuted by a fixed-point-free involution.

definition

Invfpf(Fin(n+2))Fin(n+1)×Invfpf(Fin(n))\text{Inv}_{\text{fpf}}(\text{Fin}(n+2)) \simeq \text{Fin}(n+1) \times \text{Inv}_{\text{fpf}}(\text{Fin}(n))

#involutionNoFixedZeroEquivProd

For any natural number nn, there exists an equivalence (bijection) between the set of fixed-point-free involutions on Fin(n+2)={0,1,,n+1}\text{Fin}(n+2) = \{0, 1, \dots, n+1\} and the Cartesian product of Fin(n+1)={0,1,,n}\text{Fin}(n+1) = \{0, 1, \dots, n\} and the set of fixed-point-free involutions on Fin(n)={0,1,,n1}\text{Fin}(n) = \{0, 1, \dots, n-1\}. An involution is a function ff such that ff=idf \circ f = \text{id}, and it is fixed-point-free if f(i)if(i) \neq i for all ii. This equivalence represents the fact that any fixed-point-free involution of n+2n+2 elements can be decomposed into the choice of which element 00 is mapped to (one of n+1n+1 possibilities) and a fixed-point-free involution on the remaining nn elements.

instance

The set of fixed-point free involutions on {0,,n1}\{0, \dots, n-1\} is finite

#instFintypeSubtypeForallFinAndInvolutiveForallNe_physlib

For any natural number nn, the set of functions f:{0,1,,n1}{0,1,,n1}f: \{0, 1, \dots, n-1\} \to \{0, 1, \dots, n-1\} that are involutions (i.e., f(f(i))=if(f(i)) = i for all ii) and have no fixed points (i.e., f(i)if(i) \neq i for all ii) is finite.

theorem

Invfpf(Fin(n+2))=(n+1)Invfpf(Fin(n))|\text{Inv}_{\text{fpf}}(\text{Fin}(n+2))| = (n+1) \cdot |\text{Inv}_{\text{fpf}}(\text{Fin}(n))|

#involutionNoFixed_card_succ

For any natural number nn, the cardinality of the set of fixed-point-free involutions on Fin(n+2)\text{Fin}(n+2) is equal to (n+1)(n+1) times the cardinality of the set of fixed-point-free involutions on Fin(n)\text{Fin}(n). An involution ff is a function such that f(f(i))=if(f(i)) = i for all ii, and it is fixed-point-free if f(i)if(i) \neq i for all ii.

theorem

Invfpf(Fin(2n))=(2n1)!!|\text{Inv}_{\text{fpf}}(\text{Fin}(2n))| = (2n - 1)!!

#involutionNoFixed_card_mul_two

For any natural number nn, the cardinality of the set of fixed-point-free involutions on the set Fin(2n)={0,1,,2n1}\text{Fin}(2n) = \{0, 1, \dots, 2n-1\} is equal to the double factorial (2n1)!!(2n - 1)!!. An involution ff is a function such that f(f(i))=if(f(i)) = i for all ii, and it is fixed-point-free if f(i)if(i) \neq i for all ii.

theorem

Invfpf(Fin(2n+1))=0|\text{Inv}_{\text{fpf}}(\text{Fin}(2n+1))| = 0

#involutionNoFixed_card_mul_two_plus_one

For any natural number nn, the cardinality of the set of fixed-point-free involutions on the set Fin(2n+1)={0,1,,2n}\text{Fin}(2n+1) = \{0, 1, \dots, 2n\} is 00. An involution ff is a function such that f(f(i))=if(f(i)) = i for all ii, and it is fixed-point-free if f(i)if(i) \neq i for all ii.

theorem

For even nn, Invfpf(Fin(n))=(n1)!!|\text{Inv}_{\text{fpf}}(\text{Fin}(n))| = (n - 1)!!

#involutionNoFixed_card_even

For any even natural number nn, the cardinality of the set of fixed-point-free involutions on the set Fin(n)={0,1,,n1}\text{Fin}(n) = \{0, 1, \dots, n-1\} is equal to the double factorial (n1)!!(n - 1)!!. A function f:Fin(n)Fin(n)f: \text{Fin}(n) \to \text{Fin}(n) is an involution if f(f(i))=if(f(i)) = i for all ii, and it is fixed-point-free if f(i)if(i) \neq i for all ii.

theorem

Invfpf(Fin(n))=0|\text{Inv}_{\text{fpf}}(\text{Fin}(n))| = 0 for odd nn

#involutionNoFixed_card_odd

For any odd natural number nn, the cardinality of the set of fixed-point-free involutions on the set Fin(n)={0,1,,n1}\text{Fin}(n) = \{0, 1, \dots, n-1\} is 00. An involution ff is a function such that f(f(i))=if(f(i)) = i for all iFin(n)i \in \text{Fin}(n), and it is fixed-point-free if f(i)if(i) \neq i for all iFin(n)i \in \text{Fin}(n).