PhyslibSearch

Physlib.Electromagnetism.Kinematics.MagneticField

30 declarations

theorem

B=×A\mathbf{B} = \nabla \times \mathbf{A}

#magneticField_eq

For an electromagnetic potential AA and a given speed of light cc, the magnetic field B\mathbf{B} is equal to the curl of the vector potential A\mathbf{A}. That is, for any time tt and spatial position x\mathbf{x}, the field is given by: B(t,x)=×A(t,x)\mathbf{B}(t, \mathbf{x}) = \nabla \times \mathbf{A}(t, \mathbf{x})

theorem

Bx=FyzB_x = -F_{yz}

#magneticField_fst_eq_fieldStrengthMatrix

For an electromagnetic potential AA and a speed of light cc, let B(t,x)\mathbf{B}(t, \mathbf{x}) be the magnetic field at time tt and spatial position x\mathbf{x}, and let FF be the field strength matrix (Faraday tensor). If AA is differentiable, then the first component (the xx-component) of the magnetic field is equal to the negative of the (y,z)(y, z) spatial component of the field strength matrix: Bx(t,x)=Fyz(t,x)B_x(t, \mathbf{x}) = -F_{yz}(t, \mathbf{x}) Here, the index 00 of the magnetic field corresponds to the xx-direction, and the indices 11 and 22 of the spatial part of the field strength matrix correspond to the yy and zz directions, respectively.

theorem

The second component of the magnetic field B1B_1 equals the field strength matrix component F0,2F_{0,2}

#magneticField_snd_eq_fieldStrengthMatrix

For an electromagnetic potential AA and a given speed of light cc, let B\mathbf{B} be the associated magnetic field and FF be the field strength matrix (Faraday tensor). If AA is differentiable, then the second component of the magnetic field B\mathbf{B} at time tt and spatial position x\mathbf{x} is equal to the entry of the field strength matrix corresponding to the first and third spatial indices. Mathematically, this is expressed as: B1(t,x)=Finr 0,inr 2(P)B_1(t, \mathbf{x}) = F_{\text{inr } 0, \text{inr } 2}(P) where P=(t,x)P = (t, \mathbf{x}) is the coordinate in spacetime, and indices 0,1,20, 1, 2 represent the spatial dimensions.

theorem

B2=F01B_2 = -F_{01}

#magneticField_thd_eq_fieldStrengthMatrix

Let cc be the speed of light and AA be a differentiable electromagnetic potential. For any time tt and spatial position x\mathbf{x}, the third component of the magnetic field B\mathbf{B} is equal to the negative of the component of the field strength matrix FF corresponding to the first and second spatial indices. That is, B2(t,x)=F01(t,x)B_2(t, \mathbf{x}) = -F_{01}(t, \mathbf{x}) where the indices 00 and 11 on the right-hand side refer to the first two spatial dimensions in the spacetime index set.

theorem

The divergence of the magnetic field is zero (B=0\nabla \cdot \mathbf{B} = 0)

#magneticField_div_eq_zero

Let AA be an electromagnetic potential that is twice continuously differentiable (C2\mathcal{C}^2) with respect to the real numbers. For any given time tt, the spatial divergence of the magnetic field B\mathbf{B} at that time is zero. That is: B(t,x)=0\nabla \cdot \mathbf{B}(t, \mathbf{x}) = 0 where B\mathbf{B} is the magnetic field defined by the curl of the vector potential A\mathbf{A} associated with AA.

theorem

Components of the Field Strength Matrix FμνF_{\mu\nu} in terms of E\mathbf{E} and B\mathbf{B}

#fieldStrengthMatrix_eq_electric_magnetic

Let cc be the speed of light and AA be a differentiable electromagnetic potential. For any time tt and spatial position xR3\mathbf{x} \in \mathbb{R}^3, the field strength matrix (Faraday tensor) FμνF_{\mu\nu} at the spacetime point (t,x)(t, \mathbf{x}) is expressed in terms of the components of the electric field E=(E0,E1,E2)\mathbf{E} = (E_0, E_1, E_2) and the magnetic field B=(B0,B1,B2)\mathbf{B} = (B_0, B_1, B_2) as follows: 1. The time-time component is zero: F00=0F_{00} = 0. 2. The time-space and space-time components are given by the electric field: F0,i+1=EicF_{0, i+1} = -\frac{E_i}{c} and Fi+1,0=EicF_{i+1, 0} = \frac{E_i}{c} for i{0,1,2}i \in \{0, 1, 2\}. 3. The spatial components Fi+1,j+1F_{i+1, j+1} for i,j{0,1,2}i, j \in \{0, 1, 2\} are given by: Fspatial=(0B2B1B20B0B1B00)F_{spatial} = \begin{pmatrix} 0 & -B_2 & B_1 \\ B_2 & 0 & -B_0 \\ -B_1 & B_0 & 0 \end{pmatrix} Specifically: - F11=F22=F33=0F_{11} = F_{22} = F_{33} = 0 - F12=B2,F21=B2F_{12} = -B_2, \quad F_{21} = B_2 - F13=B1,F31=B1F_{13} = B_1, \quad F_{31} = -B_1 - F23=B0,F32=B0F_{23} = -B_0, \quad F_{32} = B_0

theorem

Components of the Faraday tensor FμνF_{\mu\nu} at spacetime point xx in terms of E\mathbf{E} and B\mathbf{B}

#fieldStrengthMatrix_eq_electric_magnetic_of_spaceTime

Let cc be the speed of light and AA be a differentiable electromagnetic potential. For any point xx in spacetime, let (t,x)(t, \mathbf{x}) be the corresponding time and spatial coordinates. The components of the field strength matrix (Faraday tensor) FμνF_{\mu\nu} at the point xx are determined by the electric field E(t,x)=(E0,E1,E2)\mathbf{E}(t, \mathbf{x}) = (E_0, E_1, E_2) and the magnetic field B(t,x)=(B0,B1,B2)\mathbf{B}(t, \mathbf{x}) = (B_0, B_1, B_2) according to the following relations: 1. The temporal component is zero: F00=0F_{00} = 0. 2. The mixed temporal-spatial components are given by the electric field: F0,i+1=EicF_{0, i+1} = -\frac{E_i}{c} and Fi+1,0=EicF_{i+1, 0} = \frac{E_i}{c} for i{0,1,2}i \in \{0, 1, 2\}. 3. The spatial components Fi+1,j+1F_{i+1, j+1} for i,j{0,1,2}i, j \in \{0, 1, 2\} form the following antisymmetric matrix: (F11F12F13F21F22F23F31F32F33)=(0B2B1B20B0B1B00)\begin{pmatrix} F_{11} & F_{12} & F_{13} \\ F_{21} & F_{22} & F_{23} \\ F_{31} & F_{32} & F_{33} \end{pmatrix} = \begin{pmatrix} 0 & -B_2 & B_1 \\ B_2 & 0 & -B_0 \\ -B_1 & B_0 & 0 \end{pmatrix} Specifically, F12=B2F_{12} = -B_2, F13=B1F_{13} = B_1, F23=B0F_{23} = -B_0, and the diagonal elements are zero.

theorem

The magnetic field matrix consists of the spatial components of the field strength matrix

#magneticFieldMatrix_eq

For a speed of light cc and an electromagnetic potential AA in dd spatial dimensions, the magnetic field matrix BB at time tt and spatial position x\mathbf{x} is defined by the spatial components of the field strength matrix FF. Specifically, for any spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, the entry Bij(t,x)B_{ij}(t, \mathbf{x}) is equal to the component of the field strength matrix FF evaluated at the spacetime point corresponding to (t,x)(t, \mathbf{x}) with the indices μ,ν\mu, \nu corresponding to the ii-th and jj-th spatial components: Bij(t,x)=Fij(t,x)B_{ij}(t, \mathbf{x}) = F_{ij}(t, \mathbf{x})

theorem

The spatial components of the field strength matrix FF equal the magnetic field matrix BB

#fieldStrengthMatrix_inr_inr_eq_magneticFieldMatrix

For a given speed of light cc and an electromagnetic potential AA in dd spatial dimensions, the spatial-spatial components of the field strength matrix FF at a spacetime point xx are equal to the components of the magnetic field matrix BB at the corresponding time tt and spatial position x\mathbf{x}. Specifically, for any spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, it holds that: Fij(x)=Bij(t,x)F_{ij}(x) = B_{ij}(t, \mathbf{x}) where t=time(x,c)t = \text{time}(x, c) and x=space(x)\mathbf{x} = \text{space}(x).

theorem

The magnetic field matrix is antisymmetric (Bij=BjiB_{ij} = -B_{ji})

#magneticFieldMatrix_antisymm

For an electromagnetic potential AA in dd spatial dimensions and a speed of light cc, the magnetic field matrix BB evaluated at time tt and spatial position x\mathbf{x} is antisymmetric. Specifically, for any spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, the entries of the matrix satisfy: Bij(t,x)=Bji(t,x)B_{ij}(t, \mathbf{x}) = -B_{ji}(t, \mathbf{x})

theorem

Diagonal elements of the magnetic field matrix are zero

#magneticFieldMatrix_diag_eq_zero

For an electromagnetic potential AA in dd spatial dimensions and a speed of light cc, the diagonal entries of the magnetic field matrix B(t,x)B(t, \mathbf{x}) are zero for any time tt and spatial position x\mathbf{x}. Specifically, for any spatial index i{0,,d1}i \in \{0, \dots, d-1\}, the entry Bii(t,x)B_{ii}(t, \mathbf{x}) satisfies: Bii(t,x)=0B_{ii}(t, \mathbf{x}) = 0

theorem

Magnetic field vector in terms of the magnetic field matrix

#magneticField_eq_magneticFieldMatrix

For an electromagnetic potential AA in 3 spatial dimensions and a given speed of light cc, if AA is differentiable, then the magnetic field vector B\mathbf{B} at time tt and spatial position x\mathbf{x} is determined by the entries of the magnetic field matrix BijB_{ij} as follows: B0(t,x)=B1,2(t,x)B_0(t, \mathbf{x}) = -B_{1, 2}(t, \mathbf{x}) B1(t,x)=B0,2(t,x)B_1(t, \mathbf{x}) = B_{0, 2}(t, \mathbf{x}) B2(t,x)=B0,1(t,x)B_2(t, \mathbf{x}) = -B_{0, 1}(t, \mathbf{x}) where the indices 0,1,20, 1, 2 correspond to the three spatial dimensions.

theorem

The ii-th component of the curl of the magnetic field satisfies (×B)i=jjBji(\nabla \times \mathbf{B})_i = \sum_j \partial_j B_{ji}

#magneticField_curl_eq_magneticFieldMatrix

For an electromagnetic potential AA in 3-dimensional space that is twice continuously differentiable (C2C^2), and given a speed of light cc, the ii-th component of the curl of the magnetic field B\mathbf{B} at time tt and spatial position x\mathbf{x} is equal to the sum of the partial derivatives of the entries of the magnetic field matrix BjiB_{ji} with respect to the jj-th spatial coordinate: (×B)i(t,x)=j=02xjBji(t,x)(\nabla \times \mathbf{B})_i(t, \mathbf{x}) = \sum_{j=0}^2 \frac{\partial}{\partial x_j} B_{ji}(t, \mathbf{x}) where B\mathbf{B} is the magnetic field vector and BjiB_{ji} denotes the components of the magnetic field matrix.

theorem

Bij=jAiiAjB_{ij} = \partial_j A_i - \partial_i A_j

#magneticFieldMatrix_eq_vectorPotential

For an electromagnetic potential AA in dd spatial dimensions that is differentiable, and given a speed of light cc, the components of the magnetic field matrix BB at time tt and spatial position x\mathbf{x} are given by the difference of the partial derivatives of the vector potential components: Bij(t,x)=jAi(t,x)iAj(t,x)B_{ij}(t, \mathbf{x}) = \partial_j A_i(t, \mathbf{x}) - \partial_i A_j(t, \mathbf{x}) where Ak(t,x)A_k(t, \mathbf{x}) is the kk-th component of the vector potential A\vec{A} at time tt and position x\mathbf{x}, and k\partial_k denotes the partial derivative with respect to the kk-th spatial coordinate for indices i,j{1,,d}i, j \in \{1, \dots, d\}.

theorem

The Magnetic Field Matrix is CnC^n if the Potential is Cn+1C^{n+1}

#magneticFieldMatrix_contDiff

Let dd be the spatial dimension and cc be the speed of light. For an electromagnetic potential AA, if AA is Cn+1C^{n+1} smooth, then for any indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix, Bij(t,x)B_{ij}(t, x), is CnC^n smooth as a function of time tt and spatial position xx.

theorem

The Magnetic Field Matrix is CnC^n in Space if the Potential is Cn+1C^{n+1}

#magneticFieldMatrix_space_contDiff

Let dd be the spatial dimension and cc be the speed of light. For an electromagnetic potential AA, if AA is Cn+1C^{n+1} smooth, then for any fixed time tt and any indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix, Bij(t,x)B_{ij}(t, x), is CnC^n smooth as a function of the spatial position xx.

theorem

The Magnetic Field Matrix is CnC^n in Time if the Potential is Cn+1C^{n+1}

#magneticFieldMatrix_time_contDiff

Let dd be the spatial dimension and cc be the speed of light. For an electromagnetic potential AA, if AA is Cn+1C^{n+1} smooth, then for any fixed spatial position xx and any indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix Bij(t,x)B_{ij}(t, x) is CnC^n smooth as a function of time tt.

theorem

The Magnetic Field Matrix Bij(t,x)B_{ij}(t, x) is Differentiable for C2C^2 Potentials AA

#magneticFieldMatrix_differentiable

For a given spatial dimension dd and speed of light cc, let AA be an electromagnetic potential that is twice continuously differentiable (C2C^2) over the space-time manifold. Then, for any indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix Bij(t,x)B_{ij}(t, x) is differentiable with respect to the pair (t,x)(t, x), where tt denotes time and xx denotes the spatial position.

theorem

The Magnetic Field Matrix Bij(t,x)B_{ij}(t, x) is Spatially Differentiable for C2C^2 Potentials AA

#magneticFieldMatrix_differentiable_space

For a given spatial dimension dd and speed of light cc, let AA be an electromagnetic potential that is twice continuously differentiable (C2C^2). For any fixed time tt and indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix Bij(t,x)B_{ij}(t, x) is differentiable with respect to the spatial position xSpace dx \in \text{Space } d.

theorem

The Magnetic Field Matrix Bij(t,x)B_{ij}(t, x) is Differentiable with respect to Time for C2C^2 Potentials AA

#magneticFieldMatrix_differentiable_time

For a given spatial dimension dd and speed of light cc, let AA be an electromagnetic potential that is twice continuously differentiable (C2C^2). Then, for any fixed spatial position xx and any indices ii and jj, the (i,j)(i, j)-th component of the magnetic field matrix Bij(t,x)B_{ij}(t, x) is differentiable with respect to time tt.

theorem

Spatial derivative identity kBij=iBkjjBki\partial_k B_{ij} = \partial_i B_{kj} - \partial_j B_{ki} for the magnetic field matrix

#magneticFieldMatrix_space_deriv_eq

For an electromagnetic potential AA in dd spatial dimensions that is twice continuously differentiable (C2C^2), let Bij(t,x)B_{ij}(t, \mathbf{x}) denote the components of the magnetic field matrix at time tt and spatial position x\mathbf{x}. For any spatial indices i,j,k{1,,d}i, j, k \in \{1, \dots, d\}, the following identity holds: kBij(t,x)=iBkj(t,x)jBki(t,x)\partial_k B_{ij}(t, \mathbf{x}) = \partial_i B_{kj}(t, \mathbf{x}) - \partial_j B_{ki}(t, \mathbf{x}) where m\partial_m denotes the partial derivative with respect to the mm-th spatial coordinate.

theorem

Faraday's Law for the Magnetic Field Matrix: Bijt=iEjjEi\frac{\partial B_{ij}}{\partial t} = \partial_i E_j - \partial_j E_i

#time_deriv_magneticFieldMatrix

For a given spatial dimension dd and speed of light cc, let AA be an electromagnetic potential that is twice continuously differentiable (C2C^2). For any time tt, spatial position x\mathbf{x}, and spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, the time derivative of the (i,j)(i, j)-th component of the magnetic field matrix BijB_{ij} is given by the difference of the spatial derivatives of the electric field components: Bij(t,x)t=iEj(t,x)jEi(t,x)\frac{\partial B_{ij}(t, \mathbf{x})}{\partial t} = \partial_i E_j(t, \mathbf{x}) - \partial_j E_i(t, \mathbf{x}) where Ek(t,x)E_k(t, \mathbf{x}) is the kk-th component of the electric field at time tt and position x\mathbf{x}, and m\partial_m denotes the partial derivative with respect to the mm-th spatial coordinate.

theorem

Second Time Derivative of the Magnetic Field Matrix: 2Bijt2=i(tEj)j(tEi)\frac{\partial^2 B_{ij}}{\partial t^2} = \partial_i (\partial_t E_j) - \partial_j (\partial_t E_i)

#time_deriv_time_deriv_magneticFieldMatrix

For an electromagnetic potential AA in dd spatial dimensions that is thrice continuously differentiable (C3C^3), let Bij(t,x)B_{ij}(t, \mathbf{x}) be the components of the magnetic field matrix and Ek(t,x)E_k(t, \mathbf{x}) be the components of the electric field at time tt and spatial position x\mathbf{x}. For any spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, the second partial derivative of the magnetic field matrix components with respect to time is given by: 2Bij(t,x)t2=i(Ej(t,x)t)j(Ei(t,x)t)\frac{\partial^2 B_{ij}(t, \mathbf{x})}{\partial t^2} = \partial_i \left( \frac{\partial E_j(t, \mathbf{x})}{\partial t} \right) - \partial_j \left( \frac{\partial E_i(t, \mathbf{x})}{\partial t} \right) where k\partial_k denotes the partial derivative with respect to the kk-th spatial coordinate and t\partial_t denotes the partial derivative with respect to time.

theorem

jjBji=1c2tEi+μμFμi\sum_j \partial_j B_{ji} = \frac{1}{c^2} \partial_t E_i + \sum_\mu \partial_\mu F_{\mu i}

#curl_magneticFieldMatrix_eq_electricField_fieldStrengthMatrix

Given a spatial dimension dd and speed of light cc, let AA be an electromagnetic potential that is twice continuously differentiable (C2C^2). For any time tt, spatial position xx, and spatial index i{1,,d}i \in \{1, \dots, d\}, the divergence-like sum of the magnetic field matrix BB satisfies the following identity: j=1djBji(t,x)=1c2Ei(t,x)t+μ=0dμFμi(t,x) \sum_{j=1}^d \partial_j B_{ji}(t, x) = \frac{1}{c^2} \frac{\partial E_i(t, x)}{\partial t} + \sum_{\mu=0}^d \partial_\mu F_{\mu i}(t, x) where BjiB_{ji} are the components of the magnetic field matrix, EiE_i is the ii-th component of the electric field, and FμiF_{\mu i} are the components of the field strength matrix. The index jj ranges over the spatial dimensions, while μ\mu ranges over both time (index 0) and space.

definition

Magnetic field matrix of a distributional electromagnetic potential AA

#magneticFieldMatrix

For a given spatial dimension dd and speed of light cc, the magnetic field matrix is a linear map that associates a distributional electromagnetic potential AA with a distribution mapping test functions on spacetime (Time ×\times Space dd) to the tensor product space RdRd\mathbb{R}^d \otimes \mathbb{R}^d. This map is defined by extracting the spatial-spatial components of the field strength distribution FμνF_{\mu\nu}. For a test function ε\varepsilon, the (i,j)(i, j)-th component of the resulting matrix corresponds to the distributional derivative jAiiAj\partial_j A_i - \partial_i A_j, where AiA_i and AjA_j are the spatial components of the vector potential.

theorem

The Magnetic Field Matrix Bij=jAiiAjB_{ij} = \partial_j A_i - \partial_i A_j for Distributional Potentials

#magneticFieldMatrix_eq_vectorPotential

For a given spatial dimension dd and speed of light cc, let AA be a distributional electromagnetic potential and ε\varepsilon be a test function in the Schwartz space S(Time×Spaced,R)\mathcal{S}(\text{Time} \times \text{Space}^d, \mathbb{R}). The magnetic field matrix distribution evaluated at ε\varepsilon is given by the sum over spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}: B(ε)=i=1dj=1d(jAi(ε)iAj(ε))eiej B(\varepsilon) = \sum_{i=1}^d \sum_{j=1}^d \left( \partial_j A_i(\varepsilon) - \partial_i A_j(\varepsilon) \right) \mathbf{e}_i \otimes \mathbf{e}_j where AiA_i is the ii-th component of the distributional vector potential, j\partial_j denotes the distributional partial derivative with respect to the jj-th spatial coordinate, and eiej\mathbf{e}_i \otimes \mathbf{e}_j are the basis elements of the tensor product space RdRd\mathbb{R}^d \otimes \mathbb{R}^d.

theorem

(B(ε))ij=jAi(ε)iAj(ε)(B(\varepsilon))_{ij} = \partial_j A_i(\varepsilon) - \partial_i A_j(\varepsilon) for distributional potentials

#magneticFieldMatrix_basis_repr_eq_vector_potential

For a given spatial dimension dd and speed of light cc, let AA be a distributional electromagnetic potential and εS(Time×Rd,R)\varepsilon \in \mathcal{S}(\text{Time} \times \mathbb{R}^d, \mathbb{R}) be a test function in the Schwartz space. Let B(ε)B(\varepsilon) denote the magnetic field matrix distribution evaluated at ε\varepsilon. Then, for any spatial indices i,j{1,,d}i, j \in \{1, \dots, d\}, the (i,j)(i, j)-th component of the magnetic field matrix in the standard tensor basis is given by: (B(ε))ij=jAi(ε)iAj(ε) (B(\varepsilon))_{ij} = \partial_j A_i(\varepsilon) - \partial_i A_j(\varepsilon) where AkA_k is the kk-th component of the distributional vector potential and k\partial_k denotes the distributional partial derivative with respect to the kk-th spatial coordinate.

theorem

kBij=kjAikiAj\partial_k B_{ij} = \partial_k \partial_j A_i - \partial_k \partial_i A_j for distributional potentials

#magneticFieldMatrix_distSpaceDeriv_basis_repr_eq_vector_potential

For a given spatial dimension dd and speed of light cc, let AA be a distributional electromagnetic potential and εS(Time×Rd,R)\varepsilon \in \mathcal{S}(\text{Time} \times \mathbb{R}^d, \mathbb{R}) be a test function in the Schwartz space. Let BB denote the magnetic field matrix distribution associated with AA. For any spatial indices i,j,k{1,,d}i, j, k \in \{1, \dots, d\}, the (i,j)(i, j)-th component of the kk-th distributional spatial partial derivative of the magnetic field matrix evaluated at ε\varepsilon is given by: (kB(ε))ij=kjAi(ε)kiAj(ε) (\partial_k B(\varepsilon))_{ij} = \partial_k \partial_j A_i(\varepsilon) - \partial_k \partial_i A_j(\varepsilon) where AmA_m is the mm-th component of the distributional vector potential and n\partial_n denotes the distributional partial derivative with respect to the nn-th spatial coordinate.

theorem

The magnetic field matrix BijB_{ij} equals the spatial-spatial components of the field strength FijF_{ij}

#magneticFieldMatrix_basis_repr_eq_fieldStrength

For a given spatial dimension dd and speed of light cc, let AA be a distributional electromagnetic potential and εS(Time×Spaced,R)\varepsilon \in \mathcal{S}(\text{Time} \times \text{Space}^d, \mathbb{R}) be a test function in the Schwartz space. For any spatial indices i,j{0,,d1}i, j \in \{0, \dots, d-1\}, the (i,j)(i, j)-th component of the magnetic field matrix distribution BB evaluated at ε\varepsilon is equal to the spatial-spatial (inr i,inr j)(\text{inr } i, \text{inr } j)-th component of the field strength tensor distribution FF evaluated at ε\varepsilon. This is expressed as: (B(ε))ij=(F(ε))inr i,inr j (B(\varepsilon))_{ij} = (F(\varepsilon))_{\text{inr } i, \text{inr } j} where inr i\text{inr } i and inr j\text{inr } j denote the indices in the spacetime manifold corresponding to the spatial dimensions.

theorem

The magnetic field matrix is zero in one spatial dimension (d=1d=1)

#magneticFieldMatrix_one_dim_eq_zero

For a distributional electromagnetic potential AA in one spatial dimension (d=1d = 1) and a given speed of light cc, the magnetic field matrix BB is zero (B=0B = 0).